C30H35FN2O2 — CID 142014921
[(3R)-3-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]-naphthalen-1-ylmethanone;prop-2-en-1-ol (PubChem CID 142014921) has the molecular formula C30H35FN2O2 and a molecular weight of 474.62 g/mol. Its IUPAC name is [(3R)-3-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]-naphthalen-1-ylmethanone;prop-2-en-1-ol.
| Compound Name | [(3R)-3-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]-naphthalen-1-ylmethanone;prop-2-en-1-ol |
|---|---|
| PubChem CID | 142014921 |
| Molecular Formula | C30H35FN2O2 |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | [(3R)-3-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]-naphthalen-1-ylmethanone;prop-2-en-1-ol |
| SMILES | C=CCO.O=C(c1cccc2ccccc12)N1CC[C@H](CN2CCC(c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C27H29FN2O.C3H6O/c28-24-10-8-21(9-11-24)22-13-15-29(16-14-22)18-20-12-17-30(19-20)27(31)26-7-3-5-23-4-1-2-6-25(23)26;1-2-3-4/h1-11,20,22H,12-19H2;2,4H,1,3H2/t20-;/m1./s1 |
| InChIKey | ZBARYZCGWBCBBB-VEIFNGETSA-N |
| XLogP | 5.49 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|