C29H36FN3O2 — CID 142015036
[(3R)-3-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]-[1-(3-methoxypropyl)indol-7-yl]methanone (PubChem CID 142015036) has the molecular formula C29H36FN3O2 and a molecular weight of 477.62 g/mol. Its IUPAC name is [(3R)-3-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]-[1-(3-methoxypropyl)indol-7-yl]methanone.
| Compound Name | [(3R)-3-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]-[1-(3-methoxypropyl)indol-7-yl]methanone |
|---|---|
| PubChem CID | 142015036 |
| Molecular Formula | C29H36FN3O2 |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | [(3R)-3-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyrrolidin-1-yl]-[1-(3-methoxypropyl)indol-7-yl]methanone |
| SMILES | COCCCn1ccc2cccc(C(=O)N3CC[C@H](CN4CCC(c5ccc(F)cc5)CC4)C3)c21 |
| InChI | InChI=1S/C29H36FN3O2/c1-35-19-3-14-32-18-13-25-4-2-5-27(28(25)32)29(34)33-17-10-22(21-33)20-31-15-11-24(12-16-31)23-6-8-26(30)9-7-23/h2,4-9,13,18,22,24H,3,10-12,14-17,19-21H2,1H3/t22-/m1/s1 |
| InChIKey | CMJGSCKTZHUPJN-JOCHJYFZSA-N |
| XLogP | 5.16 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|