C28H39N7O6 — CID 142017052
4-[2-[[(2S)-1-(aminodiazenyl)-2-[(2-amino-2-methylpropanoyl)amino]-3-phenylmethoxypropylidene]amino]ethoxycarbonylamino]butyl benzoate (PubChem CID 142017052) has the molecular formula C28H39N7O6 and a molecular weight of 569.66 g/mol. Its IUPAC name is 4-[2-[[(2S)-1-(aminodiazenyl)-2-[(2-amino-2-methylpropanoyl)amino]-3-phenylmethoxypropylidene]amino]ethoxycarbonylamino]butyl benzoate.
| Compound Name | 4-[2-[[(2S)-1-(aminodiazenyl)-2-[(2-amino-2-methylpropanoyl)amino]-3-phenylmethoxypropylidene]amino]ethoxycarbonylamino]butyl benzoate |
|---|---|
| PubChem CID | 142017052 |
| Molecular Formula | C28H39N7O6 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | 4-[2-[[(2S)-1-(aminodiazenyl)-2-[(2-amino-2-methylpropanoyl)amino]-3-phenylmethoxypropylidene]amino]ethoxycarbonylamino]butyl benzoate |
| SMILES | CC(C)(N)C(=O)N[C@H](COCc1ccccc1)C(=N/CCOC(=O)NCCCCOC(=O)c1ccccc1)/N=N/N |
| InChI | InChI=1S/C28H39N7O6/c1-28(2,29)26(37)33-23(20-39-19-21-11-5-3-6-12-21)24(34-35-30)31-16-18-41-27(38)32-15-9-10-17-40-25(36)22-13-7-4-8-14-22/h3-8,11-14,23H,9-10,15-20,29H2,1-2H3,(H,32,38)(H,33,37)(H2,30,31,34)/t23-/m1/s1 |
| InChIKey | BAMBJPMMBGBFCZ-HSZRJFAPSA-N |
| XLogP | 2.51 |
| TPSA | 192.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|