C28H45NO — CID 142017309
1-[4-[4-(7-ethyldecan-2-yl)cyclopenta-1,3-dien-1-yl]phenyl]ethanone;propan-1-amine (PubChem CID 142017309) has the molecular formula C28H45NO and a molecular weight of 411.67 g/mol. Its IUPAC name is 1-[4-[4-(7-ethyldecan-2-yl)cyclopenta-1,3-dien-1-yl]phenyl]ethanone;propan-1-amine.
| Compound Name | 1-[4-[4-(7-ethyldecan-2-yl)cyclopenta-1,3-dien-1-yl]phenyl]ethanone;propan-1-amine |
|---|---|
| PubChem CID | 142017309 |
| Molecular Formula | C28H45NO |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 411.35 |
| IUPAC Name | 1-[4-[4-(7-ethyldecan-2-yl)cyclopenta-1,3-dien-1-yl]phenyl]ethanone;propan-1-amine |
| SMILES | CCCC(CC)CCCCC(C)C1=CC=C(c2ccc(C(C)=O)cc2)C1.CCCN |
| InChI | InChI=1S/C25H36O.C3H9N/c1-5-9-21(6-2)11-8-7-10-19(3)24-16-17-25(18-24)23-14-12-22(13-15-23)20(4)26;1-2-3-4/h12-17,19,21H,5-11,18H2,1-4H3;2-4H2,1H3 |
| InChIKey | VCGANRHLPAAQSK-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|