About 4-ethylnonanethioic S-acid
4-ethylnonanethioic S-acid (PubChem CID 57093694) has the molecular formula C11H22OS
and a molecular weight of 202.36 g/mol. Its IUPAC name is 4-ethylnonanethioic S-acid.
Molecular Properties
| Compound Name | 4-ethylnonanethioic S-acid |
| PubChem CID | 57093694 |
| Molecular Formula | C11H22OS |
| Molecular Weight | 202.36 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 4-ethylnonanethioic S-acid |
| SMILES | CCCCCC(CC)CCC(=O)S |
| InChI | InChI=1S/C11H22OS/c1-3-5-6-7-10(4-2)8-9-11(12)13/h10H,3-9H2,1-2H3,(H,12,13) |
| InChIKey | GULBUJFMJMBPPB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylnonanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylnonanethioic S-acid?
The IUPAC name of 4-ethylnonanethioic S-acid (CID 57093694) is 4-ethylnonanethioic S-acid.
What is the SMILES notation for 4-ethylnonanethioic S-acid?
The canonical SMILES for 4-ethylnonanethioic S-acid is CCCCCC(CC)CCC(=O)S.
What is the InChIKey of 4-ethylnonanethioic S-acid?
The InChIKey is GULBUJFMJMBPPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22OS/c1-3-5-6-7-10(4-2)8-9-11(12)13/h10H,3-9H2,1-2H3,(H,12,13).
What are the key properties of 4-ethylnonanethioic S-acid?
4-ethylnonanethioic S-acid has a molecular weight of 202.36 g/mol, XLogP of 3.83, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylnonanethioic S-acid is sourced from PubChem (CID 57093694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).