C12H15N3O2 — CID 142018542
2-N-(cyclopropylmethyl)-6-methylpyridine-2,3-dicarboxamide (PubChem CID 142018542) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-N-(cyclopropylmethyl)-6-methylpyridine-2,3-dicarboxamide.
| Compound Name | 2-N-(cyclopropylmethyl)-6-methylpyridine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 142018542 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-N-(cyclopropylmethyl)-6-methylpyridine-2,3-dicarboxamide |
| SMILES | Cc1ccc(C(N)=O)c(C(=O)NCC2CC2)n1 |
| InChI | InChI=1S/C12H15N3O2/c1-7-2-5-9(11(13)16)10(15-7)12(17)14-6-8-3-4-8/h2,5,8H,3-4,6H2,1H3,(H2,13,16)(H,14,17) |
| InChIKey | JKPKWPSPRWDVCK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |