C14H16N4 — CID 142018776
5-[(2E)-5-methylhexa-2,4-dien-2-yl]-2-phenyltetrazole (PubChem CID 142018776) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 5-[(2E)-5-methylhexa-2,4-dien-2-yl]-2-phenyltetrazole.
| Compound Name | 5-[(2E)-5-methylhexa-2,4-dien-2-yl]-2-phenyltetrazole |
|---|---|
| PubChem CID | 142018776 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5-[(2E)-5-methylhexa-2,4-dien-2-yl]-2-phenyltetrazole |
| SMILES | CC(C)=C/C=C(\C)c1nnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H16N4/c1-11(2)9-10-12(3)14-15-17-18(16-14)13-7-5-4-6-8-13/h4-10H,1-3H3/b12-10+ |
| InChIKey | TUSKWTFXDJZFRI-ZRDIBKRKSA-N |
| XLogP | 3.03 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|