C17H14N8OS2 — CID 57080774
1,3-bis[(2-phenyltetrazol-5-yl)sulfanyl]propan-2-one (PubChem CID 57080774) has the molecular formula C17H14N8OS2 and a molecular weight of 410.49 g/mol. Its IUPAC name is 1,3-bis[(2-phenyltetrazol-5-yl)sulfanyl]propan-2-one.
| Compound Name | 1,3-bis[(2-phenyltetrazol-5-yl)sulfanyl]propan-2-one |
|---|---|
| PubChem CID | 57080774 |
| Molecular Formula | C17H14N8OS2 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 1,3-bis[(2-phenyltetrazol-5-yl)sulfanyl]propan-2-one |
| SMILES | O=C(CSc1nnn(-c2ccccc2)n1)CSc1nnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H14N8OS2/c26-15(11-27-16-18-22-24(20-16)13-7-3-1-4-8-13)12-28-17-19-23-25(21-17)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | VVQPWICIVJEXJY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 104.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |