C17H21ClN4S — CID 7538243
5-[[(1R,3R,4R,6R)-4-chloro-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]sulfanyl]-2-phenyltetrazole (PubChem CID 7538243) has the molecular formula C17H21ClN4S and a molecular weight of 348.90 g/mol. Its IUPAC name is 5-[[(1R,3R,4R,6R)-4-chloro-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]sulfanyl]-2-phenyltetrazole.
| Compound Name | 5-[[(1R,3R,4R,6R)-4-chloro-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]sulfanyl]-2-phenyltetrazole |
|---|---|
| PubChem CID | 7538243 |
| Molecular Formula | C17H21ClN4S |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 5-[[(1R,3R,4R,6R)-4-chloro-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]sulfanyl]-2-phenyltetrazole |
| SMILES | CC1(C)[C@@H]2C[C@@H](Sc3nnn(-c4ccccc4)n3)[C@](C)(Cl)C[C@H]21 |
| InChI | InChI=1S/C17H21ClN4S/c1-16(2)12-9-14(17(3,18)10-13(12)16)23-15-19-21-22(20-15)11-7-5-4-6-8-11/h4-8,12-14H,9-10H2,1-3H3/t12-,13-,14-,17-/m1/s1 |
| InChIKey | SSQSSYIXOVMRJG-VMUDFCTBSA-N |
| XLogP | 4.19 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|