C16H19N3O4 — CID 101086051
[(3aR,4R,6R,6aS)-2,2-dimethyl-4-(2-phenyltriazol-4-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 101086051) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is [(3aR,4R,6R,6aS)-2,2-dimethyl-4-(2-phenyltriazol-4-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aR,4R,6R,6aS)-2,2-dimethyl-4-(2-phenyltriazol-4-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 101086051 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [(3aR,4R,6R,6aS)-2,2-dimethyl-4-(2-phenyltriazol-4-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](c1cnn(-c3ccccc3)n1)O[C@@H]2CO |
| InChI | InChI=1S/C16H19N3O4/c1-16(2)22-14-12(9-20)21-13(15(14)23-16)11-8-17-19(18-11)10-6-4-3-5-7-10/h3-8,12-15,20H,9H2,1-2H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | RLPXSUMUSGPAFB-APIJFGDWSA-N |
| XLogP | 1.22 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |