C16H18N2 — CID 11862069
(2R,4S)-3,3,9-trimethyl-8-phenyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(9),6-diene (PubChem CID 11862069) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2R,4S)-3,3,9-trimethyl-8-phenyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(9),6-diene.
| Compound Name | (2R,4S)-3,3,9-trimethyl-8-phenyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(9),6-diene |
|---|---|
| PubChem CID | 11862069 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (2R,4S)-3,3,9-trimethyl-8-phenyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(9),6-diene |
| SMILES | Cc1c2c(nn1-c1ccccc1)C[C@H]1[C@@H]2C1(C)C |
| InChI | InChI=1S/C16H18N2/c1-10-14-13(9-12-15(14)16(12,2)3)17-18(10)11-7-5-4-6-8-11/h4-8,12,15H,9H2,1-3H3/t12-,15-/m0/s1 |
| InChIKey | KQMINNNRYGRYFH-WFASDCNBSA-N |
| XLogP | 3.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |