C25H24N4O2 — CID 1120801
(1R,8R)-1,3,8,10-tetramethyl-5,12-diphenyl-7,14-dioxa-4,5,11,12-tetrazatetracyclo[6.6.1.02,6.09,13]pentadeca-2(6),3,9(13),10-tetraene (PubChem CID 1120801) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is (1R,8R)-1,3,8,10-tetramethyl-5,12-diphenyl-7,14-dioxa-4,5,11,12-tetrazatetracyclo[6.6.1.02,6.09,13]pentadeca-2(6),3,9(13),10-tetraene.
| Compound Name | (1R,8R)-1,3,8,10-tetramethyl-5,12-diphenyl-7,14-dioxa-4,5,11,12-tetrazatetracyclo[6.6.1.02,6.09,13]pentadeca-2(6),3,9(13),10-tetraene |
|---|---|
| PubChem CID | 1120801 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (1R,8R)-1,3,8,10-tetramethyl-5,12-diphenyl-7,14-dioxa-4,5,11,12-tetrazatetracyclo[6.6.1.02,6.09,13]pentadeca-2(6),3,9(13),10-tetraene |
| SMILES | Cc1nn(-c2ccccc2)c2c1[C@@]1(C)C[C@@](C)(O2)c2c(C)nn(-c3ccccc3)c2O1 |
| InChI | InChI=1S/C25H24N4O2/c1-16-20-22(28(26-16)18-11-7-5-8-12-18)30-25(4)15-24(20,3)31-23-21(25)17(2)27-29(23)19-13-9-6-10-14-19/h5-14H,15H2,1-4H3/t24-,25-/m1/s1 |
| InChIKey | BSONLUOANXJZKZ-JWQCQUIFSA-N |
| XLogP | 4.98 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |