C14H14N2O2 — CID 13068072
3,5-dimethyl-1-phenyl-5,6-dihydropyrano[3,2-d]pyrazol-4-one (PubChem CID 13068072) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 3,5-dimethyl-1-phenyl-5,6-dihydropyrano[3,2-d]pyrazol-4-one.
| Compound Name | 3,5-dimethyl-1-phenyl-5,6-dihydropyrano[3,2-d]pyrazol-4-one |
|---|---|
| PubChem CID | 13068072 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3,5-dimethyl-1-phenyl-5,6-dihydropyrano[3,2-d]pyrazol-4-one |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(=O)C(C)CO2 |
| InChI | InChI=1S/C14H14N2O2/c1-9-8-18-14-12(13(9)17)10(2)15-16(14)11-6-4-3-5-7-11/h3-7,9H,8H2,1-2H3 |
| InChIKey | QLSIURQDDSZAFS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |