C16H16Br2N2O — CID 1276184
(5R,7R)-5,7-dibromo-3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-one (PubChem CID 1276184) has the molecular formula C16H16Br2N2O and a molecular weight of 412.13 g/mol. Its IUPAC name is (5R,7R)-5,7-dibromo-3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-one.
| Compound Name | (5R,7R)-5,7-dibromo-3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-one |
|---|---|
| PubChem CID | 1276184 |
| Molecular Formula | C16H16Br2N2O |
| Molecular Weight | 412.13 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | (5R,7R)-5,7-dibromo-3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-one |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(=O)[C@H](Br)C(C)(C)[C@H]2Br |
| InChI | InChI=1S/C16H16Br2N2O/c1-9-11-12(14(17)16(2,3)15(18)13(11)21)20(19-9)10-7-5-4-6-8-10/h4-8,14-15H,1-3H3/t14-,15-/m0/s1 |
| InChIKey | RTIFWUFFVFEQBA-GJZGRUSLSA-N |
| XLogP | 4.60 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.13 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|