C18H11BrN2O2 — CID 167636243
7-bromo-3-methyl-1-phenylbenzo[g]indazole-4,5-dione (PubChem CID 167636243) has the molecular formula C18H11BrN2O2 and a molecular weight of 367.20 g/mol. Its IUPAC name is 7-bromo-3-methyl-1-phenylbenzo[g]indazole-4,5-dione.
| Compound Name | 7-bromo-3-methyl-1-phenylbenzo[g]indazole-4,5-dione |
|---|---|
| PubChem CID | 167636243 |
| Molecular Formula | C18H11BrN2O2 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 7-bromo-3-methyl-1-phenylbenzo[g]indazole-4,5-dione |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(=O)C(=O)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C18H11BrN2O2/c1-10-15-16(21(20-10)12-5-3-2-4-6-12)13-8-7-11(19)9-14(13)17(22)18(15)23/h2-9H,1H3 |
| InChIKey | QNXTVEKVMIOYPL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|