C17H13N3O3S — CID 57068396
3-methyl-4-oxo-1-phenylindeno[2,1-d]pyrazole-5-sulfonamide (PubChem CID 57068396) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is 3-methyl-4-oxo-1-phenylindeno[2,1-d]pyrazole-5-sulfonamide.
| Compound Name | 3-methyl-4-oxo-1-phenylindeno[2,1-d]pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 57068396 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 3-methyl-4-oxo-1-phenylindeno[2,1-d]pyrazole-5-sulfonamide |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(=O)c1c-2cccc1S(N)(=O)=O |
| InChI | InChI=1S/C17H13N3O3S/c1-10-14-16(20(19-10)11-6-3-2-4-7-11)12-8-5-9-13(24(18,22)23)15(12)17(14)21/h2-9H,1H3,(H2,18,22,23) |
| InChIKey | VTKODEJTYQODLV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |