C27H23FN4O2S — CID 11612812
2-[4-[1-[3-(aminomethyl)phenyl]-7-fluoro-3-methylindazol-6-yl]phenyl]benzenesulfonamide (PubChem CID 11612812) has the molecular formula C27H23FN4O2S and a molecular weight of 486.57 g/mol. Its IUPAC name is 2-[4-[1-[3-(aminomethyl)phenyl]-7-fluoro-3-methylindazol-6-yl]phenyl]benzenesulfonamide.
| Compound Name | 2-[4-[1-[3-(aminomethyl)phenyl]-7-fluoro-3-methylindazol-6-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11612812 |
| Molecular Formula | C27H23FN4O2S |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 2-[4-[1-[3-(aminomethyl)phenyl]-7-fluoro-3-methylindazol-6-yl]phenyl]benzenesulfonamide |
| SMILES | Cc1nn(-c2cccc(CN)c2)c2c(F)c(-c3ccc(-c4ccccc4S(N)(=O)=O)cc3)ccc12 |
| InChI | InChI=1S/C27H23FN4O2S/c1-17-22-13-14-24(26(28)27(22)32(31-17)21-6-4-5-18(15-21)16-29)20-11-9-19(10-12-20)23-7-2-3-8-25(23)35(30,33)34/h2-15H,16,29H2,1H3,(H2,30,33,34) |
| InChIKey | IMICWTUYDFRFDX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |