C16H17BrN2O — CID 5121882
7-bromo-3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-one (PubChem CID 5121882) has the molecular formula C16H17BrN2O and a molecular weight of 333.23 g/mol. Its IUPAC name is 7-bromo-3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-one.
| Compound Name | 7-bromo-3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-one |
|---|---|
| PubChem CID | 5121882 |
| Molecular Formula | C16H17BrN2O |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 7-bromo-3,6,6-trimethyl-1-phenyl-5,7-dihydroindazol-4-one |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(=O)CC(C)(C)C2Br |
| InChI | InChI=1S/C16H17BrN2O/c1-10-13-12(20)9-16(2,3)15(17)14(13)19(18-10)11-7-5-4-6-8-11/h4-8,15H,9H2,1-3H3 |
| InChIKey | DRDVMPWQNIATID-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|