C15H15N5O — CID 40522898
(7R)-7-azido-6,6-dimethyl-1-phenyl-5,7-dihydroindazol-4-one (PubChem CID 40522898) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is (7R)-7-azido-6,6-dimethyl-1-phenyl-5,7-dihydroindazol-4-one.
| Compound Name | (7R)-7-azido-6,6-dimethyl-1-phenyl-5,7-dihydroindazol-4-one |
|---|---|
| PubChem CID | 40522898 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (7R)-7-azido-6,6-dimethyl-1-phenyl-5,7-dihydroindazol-4-one |
| SMILES | CC1(C)CC(=O)c2cnn(-c3ccccc3)c2[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C15H15N5O/c1-15(2)8-12(21)11-9-17-20(10-6-4-3-5-7-10)13(11)14(15)18-19-16/h3-7,9,14H,8H2,1-2H3/t14-/m0/s1 |
| InChIKey | WNHSITTXHWQJCQ-AWEZNQCLSA-N |
| XLogP | 3.84 |
| TPSA | 83.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|