C19H16N4O4 — CID 155979779
6',6'-dimethyl-1'-phenylspiro[3a,6a-dihydrofuro[3,4-c]pyrazole-3,5'-7H-indazole]-4,4',6-trione (PubChem CID 155979779) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is 6',6'-dimethyl-1'-phenylspiro[3a,6a-dihydrofuro[3,4-c]pyrazole-3,5'-7H-indazole]-4,4',6-trione.
| Compound Name | 6',6'-dimethyl-1'-phenylspiro[3a,6a-dihydrofuro[3,4-c]pyrazole-3,5'-7H-indazole]-4,4',6-trione |
|---|---|
| PubChem CID | 155979779 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 6',6'-dimethyl-1'-phenylspiro[3a,6a-dihydrofuro[3,4-c]pyrazole-3,5'-7H-indazole]-4,4',6-trione |
| SMILES | CC1(C)Cc2c(cnn2-c2ccccc2)C(=O)C12N=NC1C(=O)OC(=O)C12 |
| InChI | InChI=1S/C19H16N4O4/c1-18(2)8-12-11(9-20-23(12)10-6-4-3-5-7-10)15(24)19(18)13-14(21-22-19)17(26)27-16(13)25/h3-7,9,13-14H,8H2,1-2H3 |
| InChIKey | JHHMBBPOJULBLP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 102.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|