C18H21N3O — CID 102454416
N-(6,6-dimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)prop-2-enamide (PubChem CID 102454416) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is N-(6,6-dimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)prop-2-enamide.
| Compound Name | N-(6,6-dimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 102454416 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-(6,6-dimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC1CC(C)(C)Cc2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C18H21N3O/c1-4-17(22)20-15-10-18(2,3)11-16-14(15)12-19-21(16)13-8-6-5-7-9-13/h4-9,12,15H,1,10-11H2,2-3H3,(H,20,22) |
| InChIKey | XJDKBLWACSJMEW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|