C22H29N3O — CID 42595969
(E)-N-[(4R)-6,6-dimethyl-1-(4-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-4-methylpent-2-enamide (PubChem CID 42595969) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is (E)-N-[(4R)-6,6-dimethyl-1-(4-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-4-methylpent-2-enamide.
| Compound Name | (E)-N-[(4R)-6,6-dimethyl-1-(4-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 42595969 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (E)-N-[(4R)-6,6-dimethyl-1-(4-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-4-methylpent-2-enamide |
| SMILES | Cc1ccc(-n2ncc3c2CC(C)(C)C[C@H]3NC(=O)/C=C/C(C)C)cc1 |
| InChI | InChI=1S/C22H29N3O/c1-15(2)6-11-21(26)24-19-12-22(4,5)13-20-18(19)14-23-25(20)17-9-7-16(3)8-10-17/h6-11,14-15,19H,12-13H2,1-5H3,(H,24,26)/b11-6+/t19-/m1/s1 |
| InChIKey | SGTVXCKJXUVBOX-SSGOSMAHSA-N |
| XLogP | 4.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|