C22H25N5O — CID 42513151
(E)-N-[(4S)-6,6-dimethyl-1-(4-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-3-(1H-imidazol-5-yl)prop-2-enamide (PubChem CID 42513151) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is (E)-N-[(4S)-6,6-dimethyl-1-(4-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-3-(1H-imidazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[(4S)-6,6-dimethyl-1-(4-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-3-(1H-imidazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 42513151 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (E)-N-[(4S)-6,6-dimethyl-1-(4-methylphenyl)-5,7-dihydro-4H-indazol-4-yl]-3-(1H-imidazol-5-yl)prop-2-enamide |
| SMILES | Cc1ccc(-n2ncc3c2CC(C)(C)C[C@@H]3NC(=O)/C=C/c2cnc[nH]2)cc1 |
| InChI | InChI=1S/C22H25N5O/c1-15-4-7-17(8-5-15)27-20-11-22(2,3)10-19(18(20)13-25-27)26-21(28)9-6-16-12-23-14-24-16/h4-9,12-14,19H,10-11H2,1-3H3,(H,23,24)(H,26,28)/b9-6+/t19-/m0/s1 |
| InChIKey | VUDCYNKXBPZCHQ-AIADIJKESA-N |
| XLogP | 3.75 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|