C12H11N3O3S — CID 10612565
1-methyl-2,2-dioxo-7-phenylpyrazolo[5,4-c]thiazin-4-one (PubChem CID 10612565) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 1-methyl-2,2-dioxo-7-phenylpyrazolo[5,4-c]thiazin-4-one.
| Compound Name | 1-methyl-2,2-dioxo-7-phenylpyrazolo[5,4-c]thiazin-4-one |
|---|---|
| PubChem CID | 10612565 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 1-methyl-2,2-dioxo-7-phenylpyrazolo[5,4-c]thiazin-4-one |
| SMILES | CN1c2c(cnn2-c2ccccc2)C(=O)CS1(=O)=O |
| InChI | InChI=1S/C12H11N3O3S/c1-14-12-10(11(16)8-19(14,17)18)7-13-15(12)9-5-3-2-4-6-9/h2-7H,8H2,1H3 |
| InChIKey | ZHEPCIVPAAMXFS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |