C15H14N4 — CID 175894939
8-methyl-5-phenyl-4,5,9,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,10-tetraene (PubChem CID 175894939) has the molecular formula C15H14N4 and a molecular weight of 250.31 g/mol. Its IUPAC name is 8-methyl-5-phenyl-4,5,9,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,10-tetraene.
| Compound Name | 8-methyl-5-phenyl-4,5,9,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,10-tetraene |
|---|---|
| PubChem CID | 175894939 |
| Molecular Formula | C15H14N4 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 8-methyl-5-phenyl-4,5,9,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,10-tetraene |
| SMILES | CC1Cc2c(cnn2-c2ccccc2)-c2cncn21 |
| InChI | InChI=1S/C15H14N4/c1-11-7-14-13(15-9-16-10-18(11)15)8-17-19(14)12-5-3-2-4-6-12/h2-6,8-11H,7H2,1H3 |
| InChIKey | UOSBGOHMELXFMT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |