C12H13N3O — CID 139581203
(5R)-5-methyl-5,6-dihydroimidazo[1,5-d][1,4]benzoxazepin-8-amine (PubChem CID 139581203) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is (5R)-5-methyl-5,6-dihydroimidazo[1,5-d][1,4]benzoxazepin-8-amine.
| Compound Name | (5R)-5-methyl-5,6-dihydroimidazo[1,5-d][1,4]benzoxazepin-8-amine |
|---|---|
| PubChem CID | 139581203 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (5R)-5-methyl-5,6-dihydroimidazo[1,5-d][1,4]benzoxazepin-8-amine |
| SMILES | C[C@@H]1COc2c(N)cccc2-c2cncn21 |
| InChI | InChI=1S/C12H13N3O/c1-8-6-16-12-9(3-2-4-10(12)13)11-5-14-7-15(8)11/h2-5,7-8H,6,13H2,1H3/t8-/m1/s1 |
| InChIKey | YBHVGLCROIGRFU-MRVPVSSYSA-N |
| XLogP | 2.09 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|