C16H21N3 — CID 114695777
2-methyl-3-[5-(2-methylphenyl)imidazol-1-yl]piperidine (PubChem CID 114695777) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 2-methyl-3-[5-(2-methylphenyl)imidazol-1-yl]piperidine.
| Compound Name | 2-methyl-3-[5-(2-methylphenyl)imidazol-1-yl]piperidine |
|---|---|
| PubChem CID | 114695777 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 2-methyl-3-[5-(2-methylphenyl)imidazol-1-yl]piperidine |
| SMILES | Cc1ccccc1-c1cncn1C1CCCNC1C |
| InChI | InChI=1S/C16H21N3/c1-12-6-3-4-7-14(12)16-10-17-11-19(16)15-8-5-9-18-13(15)2/h3-4,6-7,10-11,13,15,18H,5,8-9H2,1-2H3 |
| InChIKey | QINVTCIXNGHTNF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |