C15H17N3 — CID 114720083
7-(3-cyclobutylimidazol-4-yl)-2,3-dihydro-1H-indole (PubChem CID 114720083) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 7-(3-cyclobutylimidazol-4-yl)-2,3-dihydro-1H-indole.
| Compound Name | 7-(3-cyclobutylimidazol-4-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 114720083 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 7-(3-cyclobutylimidazol-4-yl)-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(c(-c3cncn3C3CCC3)c1)NCC2 |
| InChI | InChI=1S/C15H17N3/c1-3-11-7-8-17-15(11)13(6-1)14-9-16-10-18(14)12-4-2-5-12/h1,3,6,9-10,12,17H,2,4-5,7-8H2 |
| InChIKey | FEARPUCUVFTHOY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |