C15H17N3O2 — CID 114718971
methyl 2-[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]propanoate (PubChem CID 114718971) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is methyl 2-[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]propanoate.
| Compound Name | methyl 2-[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]propanoate |
|---|---|
| PubChem CID | 114718971 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | methyl 2-[5-(2,3-dihydro-1H-indol-7-yl)imidazol-1-yl]propanoate |
| SMILES | COC(=O)C(C)n1cncc1-c1cccc2c1NCC2 |
| InChI | InChI=1S/C15H17N3O2/c1-10(15(19)20-2)18-9-16-8-13(18)12-5-3-4-11-6-7-17-14(11)12/h3-5,8-10,17H,6-7H2,1-2H3 |
| InChIKey | KGAVRGAGTVEVHV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |