C17H23N3 — CID 114716664
8-(3-pentan-2-ylimidazol-4-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 114716664) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 8-(3-pentan-2-ylimidazol-4-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-(3-pentan-2-ylimidazol-4-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 114716664 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 8-(3-pentan-2-ylimidazol-4-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CCCC(C)n1cncc1-c1cccc2c1NCCC2 |
| InChI | InChI=1S/C17H23N3/c1-3-6-13(2)20-12-18-11-16(20)15-9-4-7-14-8-5-10-19-17(14)15/h4,7,9,11-13,19H,3,5-6,8,10H2,1-2H3 |
| InChIKey | OVHXAWPLYDSCCY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |