C12H20N2 — CID 114695724
3-(2,5-dimethylpyrrol-1-yl)-2-methylpiperidine (PubChem CID 114695724) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrrol-1-yl)-2-methylpiperidine.
| Compound Name | 3-(2,5-dimethylpyrrol-1-yl)-2-methylpiperidine |
|---|---|
| PubChem CID | 114695724 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 3-(2,5-dimethylpyrrol-1-yl)-2-methylpiperidine |
| SMILES | Cc1ccc(C)n1C1CCCNC1C |
| InChI | InChI=1S/C12H20N2/c1-9-6-7-10(2)14(9)12-5-4-8-13-11(12)3/h6-7,11-13H,4-5,8H2,1-3H3 |
| InChIKey | BMWCYOQQNXGDFP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |