C11H17N3O — CID 79100245
(2S)-N-(2,5-dimethylpyrrol-1-yl)pyrrolidine-2-carboxamide (PubChem CID 79100245) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is (2S)-N-(2,5-dimethylpyrrol-1-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(2,5-dimethylpyrrol-1-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 79100245 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (2S)-N-(2,5-dimethylpyrrol-1-yl)pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(C)n1NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C11H17N3O/c1-8-5-6-9(2)14(8)13-11(15)10-4-3-7-12-10/h5-6,10,12H,3-4,7H2,1-2H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | PUJXNVNUOKZWHW-JTQLQIEISA-N |
| XLogP | 0.93 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |