C14H13ClN2O — CID 124634319
(6S)-1-(4-chlorophenyl)-6-methyl-6,7-dihydro-5H-indazol-4-one (PubChem CID 124634319) has the molecular formula C14H13ClN2O and a molecular weight of 260.72 g/mol. Its IUPAC name is (6S)-1-(4-chlorophenyl)-6-methyl-6,7-dihydro-5H-indazol-4-one.
| Compound Name | (6S)-1-(4-chlorophenyl)-6-methyl-6,7-dihydro-5H-indazol-4-one |
|---|---|
| PubChem CID | 124634319 |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (6S)-1-(4-chlorophenyl)-6-methyl-6,7-dihydro-5H-indazol-4-one |
| SMILES | C[C@@H]1CC(=O)c2cnn(-c3ccc(Cl)cc3)c2C1 |
| InChI | InChI=1S/C14H13ClN2O/c1-9-6-13-12(14(18)7-9)8-16-17(13)11-4-2-10(15)3-5-11/h2-5,8-9H,6-7H2,1H3/t9-/m0/s1 |
| InChIKey | TYJOGNNWRLPRID-VIFPVBQESA-N |
| XLogP | 3.29 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |