C20H17ClN2O — CID 17228221
6-(4-chlorophenyl)-1-(4-methylphenyl)-6,7-dihydro-5H-indazol-4-one (PubChem CID 17228221) has the molecular formula C20H17ClN2O and a molecular weight of 336.82 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-1-(4-methylphenyl)-6,7-dihydro-5H-indazol-4-one.
| Compound Name | 6-(4-chlorophenyl)-1-(4-methylphenyl)-6,7-dihydro-5H-indazol-4-one |
|---|---|
| PubChem CID | 17228221 |
| Molecular Formula | C20H17ClN2O |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 6-(4-chlorophenyl)-1-(4-methylphenyl)-6,7-dihydro-5H-indazol-4-one |
| SMILES | Cc1ccc(-n2ncc3c2CC(c2ccc(Cl)cc2)CC3=O)cc1 |
| InChI | InChI=1S/C20H17ClN2O/c1-13-2-8-17(9-3-13)23-19-10-15(11-20(24)18(19)12-22-23)14-4-6-16(21)7-5-14/h2-9,12,15H,10-11H2,1H3 |
| InChIKey | XXGNGEYGPVFSEM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |