C19H14Cl2N2O — CID 40917572
(6S)-1,6-bis(4-chlorophenyl)-6,7-dihydro-5H-indazol-4-one (PubChem CID 40917572) has the molecular formula C19H14Cl2N2O and a molecular weight of 357.24 g/mol. Its IUPAC name is (6S)-1,6-bis(4-chlorophenyl)-6,7-dihydro-5H-indazol-4-one.
| Compound Name | (6S)-1,6-bis(4-chlorophenyl)-6,7-dihydro-5H-indazol-4-one |
|---|---|
| PubChem CID | 40917572 |
| Molecular Formula | C19H14Cl2N2O |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | (6S)-1,6-bis(4-chlorophenyl)-6,7-dihydro-5H-indazol-4-one |
| SMILES | O=C1C[C@@H](c2ccc(Cl)cc2)Cc2c1cnn2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14Cl2N2O/c20-14-3-1-12(2-4-14)13-9-18-17(19(24)10-13)11-22-23(18)16-7-5-15(21)6-8-16/h1-8,11,13H,9-10H2/t13-/m0/s1 |
| InChIKey | NDJXEOHRBLXQNV-ZDUSSCGKSA-N |
| XLogP | 5.09 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |