C14H12Cl2N2O — CID 53415414
1-(2,6-dichlorophenyl)-6-methyl-6,7-dihydro-5H-indazol-4-one (PubChem CID 53415414) has the molecular formula C14H12Cl2N2O and a molecular weight of 295.17 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-6-methyl-6,7-dihydro-5H-indazol-4-one.
| Compound Name | 1-(2,6-dichlorophenyl)-6-methyl-6,7-dihydro-5H-indazol-4-one |
|---|---|
| PubChem CID | 53415414 |
| Molecular Formula | C14H12Cl2N2O |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-6-methyl-6,7-dihydro-5H-indazol-4-one |
| SMILES | CC1CC(=O)c2cnn(-c3c(Cl)cccc3Cl)c2C1 |
| InChI | InChI=1S/C14H12Cl2N2O/c1-8-5-12-9(13(19)6-8)7-17-18(12)14-10(15)3-2-4-11(14)16/h2-4,7-8H,5-6H2,1H3 |
| InChIKey | FYUBOPKGMXROCQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |