C12H13N3 — CID 83861524
1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine (PubChem CID 83861524) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine.
| Compound Name | 1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine |
|---|---|
| PubChem CID | 83861524 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-amine |
| SMILES | NC1CCc2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C12H13N3/c13-11-6-7-12-10(11)8-14-15(12)9-4-2-1-3-5-9/h1-5,8,11H,6-7,13H2 |
| InChIKey | SWRLXDJWFMZTHR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |