C22H16N2O2S — CID 157143404
2-(5-methyl-1-phenylpyrazol-4-yl)dibenzothiophene 5,5-dioxide (PubChem CID 157143404) has the molecular formula C22H16N2O2S and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-(5-methyl-1-phenylpyrazol-4-yl)dibenzothiophene 5,5-dioxide.
| Compound Name | 2-(5-methyl-1-phenylpyrazol-4-yl)dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 157143404 |
| Molecular Formula | C22H16N2O2S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-(5-methyl-1-phenylpyrazol-4-yl)dibenzothiophene 5,5-dioxide |
| SMILES | Cc1c(-c2ccc3c(c2)-c2ccccc2S3(=O)=O)cnn1-c1ccccc1 |
| InChI | InChI=1S/C22H16N2O2S/c1-15-20(14-23-24(15)17-7-3-2-4-8-17)16-11-12-22-19(13-16)18-9-5-6-10-21(18)27(22,25)26/h2-14H,1H3 |
| InChIKey | WXQCWMRAIHCPBH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |