C22H15N2O2RhS- — CID 162463196
2-(5-methyl-1-phenylpyrazol-4-yl)dibenzothiophene 5,5-dioxide;rhodium (PubChem CID 162463196) has the molecular formula C22H15N2O2RhS- and a molecular weight of 474.35 g/mol. Its IUPAC name is 2-(5-methyl-1-phenylpyrazol-4-yl)dibenzothiophene 5,5-dioxide;rhodium.
| Compound Name | 2-(5-methyl-1-phenylpyrazol-4-yl)dibenzothiophene 5,5-dioxide;rhodium |
|---|---|
| PubChem CID | 162463196 |
| Molecular Formula | C22H15N2O2RhS- |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 473.99 |
| IUPAC Name | 2-(5-methyl-1-phenylpyrazol-4-yl)dibenzothiophene 5,5-dioxide;rhodium |
| SMILES | Cc1c(-c2ccc3c(c2)-c2ccccc2S3(=O)=O)cnn1-c1[c-]cccc1.[Rh] |
| InChI | InChI=1S/C22H15N2O2S.Rh/c1-15-20(14-23-24(15)17-7-3-2-4-8-17)16-11-12-22-19(13-16)18-9-5-6-10-21(18)27(22,25)26;/h2-7,9-14H,1H3;/q-1; |
| InChIKey | OUJQBTHUAYEZCS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|