C25H26N6O2 — CID 92581872
2-(7-oxo-10-phenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl)-N-[(2S)-4-phenylbutan-2-yl]acetamide (PubChem CID 92581872) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-(7-oxo-10-phenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl)-N-[(2S)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(7-oxo-10-phenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl)-N-[(2S)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 92581872 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-(7-oxo-10-phenyl-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,11-trien-8-yl)-N-[(2S)-4-phenylbutan-2-yl]acetamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)CN1C(=O)N2CCN=C2c2cnn(-c3ccccc3)c21 |
| InChI | InChI=1S/C25H26N6O2/c1-18(12-13-19-8-4-2-5-9-19)28-22(32)17-30-24-21(23-26-14-15-29(23)25(30)33)16-27-31(24)20-10-6-3-7-11-20/h2-11,16,18H,12-15,17H2,1H3,(H,28,32)/t18-/m0/s1 |
| InChIKey | OYJYVOWFVAXYQM-SFHVURJKSA-N |
| XLogP | 3.01 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |