C13H8N2O2 — CID 102097080
1-phenylindazole-4,7-dione (PubChem CID 102097080) has the molecular formula C13H8N2O2 and a molecular weight of 224.22 g/mol. Its IUPAC name is 1-phenylindazole-4,7-dione.
| Compound Name | 1-phenylindazole-4,7-dione |
|---|---|
| PubChem CID | 102097080 |
| Molecular Formula | C13H8N2O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1-phenylindazole-4,7-dione |
| SMILES | O=C1C=CC(=O)c2c1cnn2-c1ccccc1 |
| InChI | InChI=1S/C13H8N2O2/c16-11-6-7-12(17)13-10(11)8-14-15(13)9-4-2-1-3-5-9/h1-8H |
| InChIKey | JXLXMNDJRNFQAY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|