C28H28N6O2 — CID 155979704
(4Z)-6,6-dimethyl-N-[(4-nitrophenyl)methyl]-1-phenyl-4-(phenylhydrazinylidene)-5,7-dihydroindazol-7-amine (PubChem CID 155979704) has the molecular formula C28H28N6O2 and a molecular weight of 480.57 g/mol. Its IUPAC name is (4Z)-6,6-dimethyl-N-[(4-nitrophenyl)methyl]-1-phenyl-4-(phenylhydrazinylidene)-5,7-dihydroindazol-7-amine.
| Compound Name | (4Z)-6,6-dimethyl-N-[(4-nitrophenyl)methyl]-1-phenyl-4-(phenylhydrazinylidene)-5,7-dihydroindazol-7-amine |
|---|---|
| PubChem CID | 155979704 |
| Molecular Formula | C28H28N6O2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (4Z)-6,6-dimethyl-N-[(4-nitrophenyl)methyl]-1-phenyl-4-(phenylhydrazinylidene)-5,7-dihydroindazol-7-amine |
| SMILES | CC1(C)C/C(=N/Nc2ccccc2)c2cnn(-c3ccccc3)c2C1NCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H28N6O2/c1-28(2)17-25(32-31-21-9-5-3-6-10-21)24-19-30-33(22-11-7-4-8-12-22)26(24)27(28)29-18-20-13-15-23(16-14-20)34(35)36/h3-16,19,27,29,31H,17-18H2,1-2H3/b32-25- |
| InChIKey | OJBTXSJUEJTBLS-MKCFTUBBSA-N |
| XLogP | 5.86 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|