C18H16N4O — CID 136705112
3-methyl-1,5-diphenyl-4,7-dihydropyrazolo[5,4-d]pyrimidin-6-one (PubChem CID 136705112) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-methyl-1,5-diphenyl-4,7-dihydropyrazolo[5,4-d]pyrimidin-6-one.
| Compound Name | 3-methyl-1,5-diphenyl-4,7-dihydropyrazolo[5,4-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 136705112 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-methyl-1,5-diphenyl-4,7-dihydropyrazolo[5,4-d]pyrimidin-6-one |
| SMILES | Cc1nn(-c2ccccc2)c2c1CN(c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C18H16N4O/c1-13-16-12-21(14-8-4-2-5-9-14)18(23)19-17(16)22(20-13)15-10-6-3-7-11-15/h2-11H,12H2,1H3,(H,19,23) |
| InChIKey | WKROUZAROWKHFS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |