C9H9KN2O2 — CID 173461566
potassium;hydride;1-phenylimidazolidine-2,4-dione (PubChem CID 173461566) has the molecular formula C9H9KN2O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is potassium;hydride;1-phenylimidazolidine-2,4-dione.
| Compound Name | potassium;hydride;1-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 173461566 |
| Molecular Formula | C9H9KN2O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | potassium;hydride;1-phenylimidazolidine-2,4-dione |
| SMILES | O=C1CN(c2ccccc2)C(=O)N1.[H-].[K+] |
| InChI | InChI=1S/C9H8N2O2.K.H/c12-8-6-11(9(13)10-8)7-4-2-1-3-5-7;;/h1-5H,6H2,(H,10,12,13);;/q;+1;-1 |
| InChIKey | BHNIQDZUBLLNEM-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|