About potassium;hydride;1-phenylimidazolidine-2,4-dione
potassium;hydride;1-phenylimidazolidine-2,4-dione (PubChem CID 173461566) has the molecular formula C9H9KN2O2
and a molecular weight of 216.28 g/mol. Its IUPAC name is potassium;hydride;1-phenylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | potassium;hydride;1-phenylimidazolidine-2,4-dione |
| PubChem CID | 173461566 |
| Molecular Formula | C9H9KN2O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | potassium;hydride;1-phenylimidazolidine-2,4-dione |
| SMILES | O=C1CN(c2ccccc2)C(=O)N1.[H-].[K+] |
| InChI | InChI=1S/C9H8N2O2.K.H/c12-8-6-11(9(13)10-8)7-4-2-1-3-5-7;;/h1-5H,6H2,(H,10,12,13);;/q;+1;-1 |
| InChIKey | BHNIQDZUBLLNEM-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;1-phenylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;1-phenylimidazolidine-2,4-dione?
The IUPAC name of potassium;hydride;1-phenylimidazolidine-2,4-dione (CID 173461566) is potassium;hydride;1-phenylimidazolidine-2,4-dione.
What is the SMILES notation for potassium;hydride;1-phenylimidazolidine-2,4-dione?
The canonical SMILES for potassium;hydride;1-phenylimidazolidine-2,4-dione is O=C1CN(c2ccccc2)C(=O)N1.[H-].[K+].
What is the InChIKey of potassium;hydride;1-phenylimidazolidine-2,4-dione?
The InChIKey is BHNIQDZUBLLNEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2.K.H/c12-8-6-11(9(13)10-8)7-4-2-1-3-5-7;;/h1-5H,6H2,(H,10,12,13);;/q;+1;-1.
What are the key properties of potassium;hydride;1-phenylimidazolidine-2,4-dione?
potassium;hydride;1-phenylimidazolidine-2,4-dione has a molecular weight of 216.28 g/mol, XLogP of -2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;1-phenylimidazolidine-2,4-dione is sourced from PubChem (CID 173461566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).