C11H13N3O4 — CID 174973265
2-aminoacetic acid;1-phenylimidazolidine-2,4-dione (PubChem CID 174973265) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-aminoacetic acid;1-phenylimidazolidine-2,4-dione.
| Compound Name | 2-aminoacetic acid;1-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 174973265 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 2-aminoacetic acid;1-phenylimidazolidine-2,4-dione |
| SMILES | NCC(=O)O.O=C1CN(c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C9H8N2O2.C2H5NO2/c12-8-6-11(9(13)10-8)7-4-2-1-3-5-7;3-1-2(4)5/h1-5H,6H2,(H,10,12,13);1,3H2,(H,4,5) |
| InChIKey | DQQXVJLNQLGSPA-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|