C18H19N3O5S — CID 71341028
2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 71341028) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 71341028 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | NC(Cc1ccc(O)c(O)c1)C(=O)O.O=C1CN(c2ccccc2)C(=S)N1 |
| InChI | InChI=1S/C9H8N2OS.C9H11NO4/c12-8-6-11(9(13)10-8)7-4-2-1-3-5-7;10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-5H,6H2,(H,10,12,13);1-2,4,6,11-12H,3,10H2,(H,13,14) |
| InChIKey | QPUDLQBQQZBJLY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|