C20H20N4O3S — CID 56924465
(2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 56924465) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 56924465 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;1-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O.O=C1CN(c2ccccc2)C(=S)N1 |
| InChI | InChI=1S/C11H12N2O2.C9H8N2OS/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10;12-8-6-11(9(13)10-8)7-4-2-1-3-5-7/h1-4,6,9,13H,5,12H2,(H,14,15);1-5H,6H2,(H,10,12,13)/t9-;/m0./s1 |
| InChIKey | SWKNMLRLGNXFLC-FVGYRXGTSA-N |
| XLogP | 2.03 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|