C19H23N3O3 — CID 27661508
1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethane-1,2-dione (PubChem CID 27661508) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethane-1,2-dione.
| Compound Name | 1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 27661508 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)ethane-1,2-dione |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)N1C[C@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C19H23N3O3/c1-12-10-21(11-13(2)25-12)19(24)18(23)17-14(3)20-22(15(17)4)16-8-6-5-7-9-16/h5-9,12-13H,10-11H2,1-4H3/t12-,13-/m0/s1 |
| InChIKey | UOSFJPLMWMJIIA-STQMWFEESA-N |
| XLogP | 2.31 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|