C23H31N5O2 — CID 86958295
1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 86958295) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 86958295 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)N1CCN(C2CCCN(C)C2)CC1 |
| InChI | InChI=1S/C23H31N5O2/c1-17-21(18(2)28(24-17)19-8-5-4-6-9-19)22(29)23(30)27-14-12-26(13-15-27)20-10-7-11-25(3)16-20/h4-6,8-9,20H,7,10-16H2,1-3H3 |
| InChIKey | DSBPENLIQVJYJN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|