C22H23N5O2 — CID 51260305
1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-(4-pyridin-2-ylpiperazin-1-yl)ethane-1,2-dione (PubChem CID 51260305) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-(4-pyridin-2-ylpiperazin-1-yl)ethane-1,2-dione.
| Compound Name | 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-(4-pyridin-2-ylpiperazin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 51260305 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-(4-pyridin-2-ylpiperazin-1-yl)ethane-1,2-dione |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H23N5O2/c1-16-20(17(2)27(24-16)18-8-4-3-5-9-18)21(28)22(29)26-14-12-25(13-15-26)19-10-6-7-11-23-19/h3-11H,12-15H2,1-2H3 |
| InChIKey | ZXQAOVGUZKPOAL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|